C16H15ClFNOS — CID 79698117
3-[3-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-5-fluorophenyl]prop-2-yn-1-ol (PubChem CID 79698117) has the molecular formula C16H15ClFNOS and a molecular weight of 323.82 g/mol. Its IUPAC name is 3-[3-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-5-fluorophenyl]prop-2-yn-1-ol.
| Compound Name | 3-[3-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-5-fluorophenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 79698117 |
| Molecular Formula | C16H15ClFNOS |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 3-[3-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-5-fluorophenyl]prop-2-yn-1-ol |
| SMILES | CN(Cc1cc(F)cc(C#CCO)c1)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C16H15ClFNOS/c1-19(11-15-4-5-16(17)21-15)10-13-7-12(3-2-6-20)8-14(18)9-13/h4-5,7-9,20H,6,10-11H2,1H3 |
| InChIKey | SHOWBZCRLPYHEZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|