C17H24FNO2 — CID 79698656
3-[3-fluoro-5-[[2-methoxyethyl(2-methylpropyl)amino]methyl]phenyl]prop-2-yn-1-ol (PubChem CID 79698656) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is 3-[3-fluoro-5-[[2-methoxyethyl(2-methylpropyl)amino]methyl]phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[3-fluoro-5-[[2-methoxyethyl(2-methylpropyl)amino]methyl]phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 79698656 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 3-[3-fluoro-5-[[2-methoxyethyl(2-methylpropyl)amino]methyl]phenyl]prop-2-yn-1-ol |
| SMILES | COCCN(Cc1cc(F)cc(C#CCO)c1)CC(C)C |
| InChI | InChI=1S/C17H24FNO2/c1-14(2)12-19(6-8-21-3)13-16-9-15(5-4-7-20)10-17(18)11-16/h9-11,14,20H,6-8,12-13H2,1-3H3 |
| InChIKey | LWWUDUOTKGBKQE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|