About (3S)-N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-phenylbutanehydrazide
(3S)-N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-phenylbutanehydrazide (PubChem CID 7969923) has the molecular formula C18H19FN2O2S
and a molecular weight of 346.43 g/mol. Its IUPAC name is (3S)-N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-phenylbutanehydrazide.
Molecular Properties
| Compound Name | (3S)-N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-phenylbutanehydrazide |
| PubChem CID | 7969923 |
| Molecular Formula | C18H19FN2O2S |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (3S)-N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-phenylbutanehydrazide |
| SMILES | C[C@@H](CC(=O)NNC(=O)CSc1ccccc1F)c1ccccc1 |
| InChI | InChI=1S/C18H19FN2O2S/c1-13(14-7-3-2-4-8-14)11-17(22)20-21-18(23)12-24-16-10-6-5-9-15(16)19/h2-10,13H,11-12H2,1H3,(H,20,22)(H,21,23)/t13-/m0/s1 |
| InChIKey | XJSINJSZLSHOAU-ZDUSSCGKSA-N |
| XLogP | 3.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S)-N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-phenylbutanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-phenylbutanehydrazide?
The IUPAC name of (3S)-N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-phenylbutanehydrazide (CID 7969923) is (3S)-N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-phenylbutanehydrazide.
What is the SMILES notation for (3S)-N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-phenylbutanehydrazide?
The canonical SMILES for (3S)-N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-phenylbutanehydrazide is C[C@@H](CC(=O)NNC(=O)CSc1ccccc1F)c1ccccc1.
What is the InChIKey of (3S)-N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-phenylbutanehydrazide?
The InChIKey is XJSINJSZLSHOAU-ZDUSSCGKSA-N. The full InChI is InChI=1S/C18H19FN2O2S/c1-13(14-7-3-2-4-8-14)11-17(22)20-21-18(23)12-24-16-10-6-5-9-15(16)19/h2-10,13H,11-12H2,1H3,(H,20,22)(H,21,23)/t13-/m0/s1.
What are the key properties of (3S)-N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-phenylbutanehydrazide?
(3S)-N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-phenylbutanehydrazide has a molecular weight of 346.43 g/mol, XLogP of 3.26, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-phenylbutanehydrazide is sourced from PubChem (CID 7969923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).