About 8-(4-chloro-3-methoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol
8-(4-chloro-3-methoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol (PubChem CID 79699596) has the molecular formula C17H21ClO2
and a molecular weight of 292.81 g/mol. Its IUPAC name is 8-(4-chloro-3-methoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol.
Molecular Properties
| Compound Name | 8-(4-chloro-3-methoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol |
| PubChem CID | 79699596 |
| Molecular Formula | C17H21ClO2 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 8-(4-chloro-3-methoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol |
| SMILES | COc1cc(C2(O)CC3CC2C2CCCC32)ccc1Cl |
| InChI | InChI=1S/C17H21ClO2/c1-20-16-8-11(5-6-15(16)18)17(19)9-10-7-14(17)13-4-2-3-12(10)13/h5-6,8,10,12-14,19H,2-4,7,9H2,1H3 |
| InChIKey | LFRFERWZKOKALV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-(4-chloro-3-methoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-chloro-3-methoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol?
The IUPAC name of 8-(4-chloro-3-methoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol (CID 79699596) is 8-(4-chloro-3-methoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol.
What is the SMILES notation for 8-(4-chloro-3-methoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol?
The canonical SMILES for 8-(4-chloro-3-methoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol is COc1cc(C2(O)CC3CC2C2CCCC32)ccc1Cl.
What is the InChIKey of 8-(4-chloro-3-methoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol?
The InChIKey is LFRFERWZKOKALV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClO2/c1-20-16-8-11(5-6-15(16)18)17(19)9-10-7-14(17)13-4-2-3-12(10)13/h5-6,8,10,12-14,19H,2-4,7,9H2,1H3.
What are the key properties of 8-(4-chloro-3-methoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol?
8-(4-chloro-3-methoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol has a molecular weight of 292.81 g/mol, XLogP of 3.99, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-chloro-3-methoxyphenyl)tricyclo[5.2.1.02,6]decan-8-ol is sourced from PubChem (CID 79699596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).