C15H24ClNO — CID 79700435
4-(4-chloro-3-methoxyphenyl)-N-propylpentan-2-amine (PubChem CID 79700435) has the molecular formula C15H24ClNO and a molecular weight of 269.82 g/mol. Its IUPAC name is 4-(4-chloro-3-methoxyphenyl)-N-propylpentan-2-amine.
| Compound Name | 4-(4-chloro-3-methoxyphenyl)-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 79700435 |
| Molecular Formula | C15H24ClNO |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 4-(4-chloro-3-methoxyphenyl)-N-propylpentan-2-amine |
| SMILES | CCCNC(C)CC(C)c1ccc(Cl)c(OC)c1 |
| InChI | InChI=1S/C15H24ClNO/c1-5-8-17-12(3)9-11(2)13-6-7-14(16)15(10-13)18-4/h6-7,10-12,17H,5,8-9H2,1-4H3 |
| InChIKey | DGAQMUSLQSDEET-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |