C16H23BrFN — CID 79701432
2-[(3-bromo-5-fluorophenyl)methyl]-N-ethyl-4-methylcyclohexan-1-amine (PubChem CID 79701432) has the molecular formula C16H23BrFN and a molecular weight of 328.27 g/mol. Its IUPAC name is 2-[(3-bromo-5-fluorophenyl)methyl]-N-ethyl-4-methylcyclohexan-1-amine.
| Compound Name | 2-[(3-bromo-5-fluorophenyl)methyl]-N-ethyl-4-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 79701432 |
| Molecular Formula | C16H23BrFN |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-[(3-bromo-5-fluorophenyl)methyl]-N-ethyl-4-methylcyclohexan-1-amine |
| SMILES | CCNC1CCC(C)CC1Cc1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C16H23BrFN/c1-3-19-16-5-4-11(2)6-13(16)7-12-8-14(17)10-15(18)9-12/h8-11,13,16,19H,3-7H2,1-2H3 |
| InChIKey | VBFVZRLHUQYLJA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |