C15H13BrF2O2 — CID 79702145
2-(3-bromo-5-fluorophenyl)-1-(3-fluoro-4-methoxyphenyl)ethanol (PubChem CID 79702145) has the molecular formula C15H13BrF2O2 and a molecular weight of 343.17 g/mol. Its IUPAC name is 2-(3-bromo-5-fluorophenyl)-1-(3-fluoro-4-methoxyphenyl)ethanol.
| Compound Name | 2-(3-bromo-5-fluorophenyl)-1-(3-fluoro-4-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 79702145 |
| Molecular Formula | C15H13BrF2O2 |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 2-(3-bromo-5-fluorophenyl)-1-(3-fluoro-4-methoxyphenyl)ethanol |
| SMILES | COc1ccc(C(O)Cc2cc(F)cc(Br)c2)cc1F |
| InChI | InChI=1S/C15H13BrF2O2/c1-20-15-3-2-10(7-13(15)18)14(19)6-9-4-11(16)8-12(17)5-9/h2-5,7-8,14,19H,6H2,1H3 |
| InChIKey | AHQIVGGCAXSNOG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |