About [3-fluoro-5-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]phenyl]boronic acid
[3-fluoro-5-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]phenyl]boronic acid (PubChem CID 79706584) has the molecular formula C11H9BF2N2O4
and a molecular weight of 282.01 g/mol. Its IUPAC name is [3-fluoro-5-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]phenyl]boronic acid.
Molecular Properties
| Compound Name | [3-fluoro-5-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]phenyl]boronic acid |
| PubChem CID | 79706584 |
| Molecular Formula | C11H9BF2N2O4 |
| Molecular Weight | 282.01 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | [3-fluoro-5-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]phenyl]boronic acid |
| SMILES | O=c1[nH]c(=O)n(Cc2cc(F)cc(B(O)O)c2)cc1F |
| InChI | InChI=1S/C11H9BF2N2O4/c13-8-2-6(1-7(3-8)12(19)20)4-16-5-9(14)10(17)15-11(16)18/h1-3,5,19-20H,4H2,(H,15,17,18) |
| InChIKey | LIJDXRCSHFJRIP-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.01 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3-fluoro-5-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-fluoro-5-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]phenyl]boronic acid?
The IUPAC name of [3-fluoro-5-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]phenyl]boronic acid (CID 79706584) is [3-fluoro-5-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]phenyl]boronic acid.
What is the SMILES notation for [3-fluoro-5-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]phenyl]boronic acid?
The canonical SMILES for [3-fluoro-5-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]phenyl]boronic acid is O=c1[nH]c(=O)n(Cc2cc(F)cc(B(O)O)c2)cc1F.
What is the InChIKey of [3-fluoro-5-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]phenyl]boronic acid?
The InChIKey is LIJDXRCSHFJRIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BF2N2O4/c13-8-2-6(1-7(3-8)12(19)20)4-16-5-9(14)10(17)15-11(16)18/h1-3,5,19-20H,4H2,(H,15,17,18).
What are the key properties of [3-fluoro-5-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]phenyl]boronic acid?
[3-fluoro-5-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]phenyl]boronic acid has a molecular weight of 282.01 g/mol, XLogP of -1.46, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-fluoro-5-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]phenyl]boronic acid is sourced from PubChem (CID 79706584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).