C14H27N3O — CID 79708212
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-piperidin-4-ylmethanamine (PubChem CID 79708212) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-piperidin-4-ylmethanamine.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-piperidin-4-ylmethanamine |
|---|---|
| PubChem CID | 79708212 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-piperidin-4-ylmethanamine |
| SMILES | C1CC2COC(CNCC3CCNCC3)CN2C1 |
| InChI | InChI=1S/C14H27N3O/c1-2-13-11-18-14(10-17(13)7-1)9-16-8-12-3-5-15-6-4-12/h12-16H,1-11H2 |
| InChIKey | FHUWFCIYKXQOGW-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |