C13H19BrFN — CID 79708487
1-(3-bromo-5-fluorophenyl)-4,4-dimethylpentan-2-amine (PubChem CID 79708487) has the molecular formula C13H19BrFN and a molecular weight of 288.20 g/mol. Its IUPAC name is 1-(3-bromo-5-fluorophenyl)-4,4-dimethylpentan-2-amine.
| Compound Name | 1-(3-bromo-5-fluorophenyl)-4,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 79708487 |
| Molecular Formula | C13H19BrFN |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 1-(3-bromo-5-fluorophenyl)-4,4-dimethylpentan-2-amine |
| SMILES | CC(C)(C)CC(N)Cc1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C13H19BrFN/c1-13(2,3)8-12(16)6-9-4-10(14)7-11(15)5-9/h4-5,7,12H,6,8,16H2,1-3H3 |
| InChIKey | KWUPTBPTURVFSE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |