C14H12FN3O2 — CID 79708673
3-[3-[[bis(cyanomethyl)amino]methyl]-5-fluorophenyl]prop-2-enoic acid (PubChem CID 79708673) has the molecular formula C14H12FN3O2 and a molecular weight of 273.27 g/mol. Its IUPAC name is 3-[3-[[bis(cyanomethyl)amino]methyl]-5-fluorophenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[[bis(cyanomethyl)amino]methyl]-5-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 79708673 |
| Molecular Formula | C14H12FN3O2 |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 3-[3-[[bis(cyanomethyl)amino]methyl]-5-fluorophenyl]prop-2-enoic acid |
| SMILES | N#CCN(CC#N)Cc1cc(F)cc(C=CC(=O)O)c1 |
| InChI | InChI=1S/C14H12FN3O2/c15-13-8-11(1-2-14(19)20)7-12(9-13)10-18(5-3-16)6-4-17/h1-2,7-9H,5-6,10H2,(H,19,20) |
| InChIKey | CNFVNSLTPFVYDR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|