C15H17BrFN3 — CID 79709192
N-[[1-[(3-bromo-5-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methyl]cyclopropanamine (PubChem CID 79709192) has the molecular formula C15H17BrFN3 and a molecular weight of 338.22 g/mol. Its IUPAC name is N-[[1-[(3-bromo-5-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methyl]cyclopropanamine.
| Compound Name | N-[[1-[(3-bromo-5-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 79709192 |
| Molecular Formula | C15H17BrFN3 |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | N-[[1-[(3-bromo-5-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methyl]cyclopropanamine |
| SMILES | Cc1nn(Cc2cc(F)cc(Br)c2)cc1CNC1CC1 |
| InChI | InChI=1S/C15H17BrFN3/c1-10-12(7-18-15-2-3-15)9-20(19-10)8-11-4-13(16)6-14(17)5-11/h4-6,9,15,18H,2-3,7-8H2,1H3 |
| InChIKey | NEPKYEQTUGYPMC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |