C12H14ClNO — CID 79712172
4-(4-chloro-3-methoxyphenyl)-1,2,3,6-tetrahydropyridine (PubChem CID 79712172) has the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. Its IUPAC name is 4-(4-chloro-3-methoxyphenyl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-(4-chloro-3-methoxyphenyl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 79712172 |
| Molecular Formula | C12H14ClNO |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 4-(4-chloro-3-methoxyphenyl)-1,2,3,6-tetrahydropyridine |
| SMILES | COc1cc(C2=CCNCC2)ccc1Cl |
| InChI | InChI=1S/C12H14ClNO/c1-15-12-8-10(2-3-11(12)13)9-4-6-14-7-5-9/h2-4,8,14H,5-7H2,1H3 |
| InChIKey | KNCXAXTUGLYRLN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |