C14H16FN3 — CID 79713745
N-ethyl-1-(5-fluoro-2-pyridinyl)-2-pyridin-4-ylethanamine (PubChem CID 79713745) has the molecular formula C14H16FN3 and a molecular weight of 245.30 g/mol. Its IUPAC name is N-ethyl-1-(5-fluoro-2-pyridinyl)-2-pyridin-4-ylethanamine.
| Compound Name | N-ethyl-1-(5-fluoro-2-pyridinyl)-2-pyridin-4-ylethanamine |
|---|---|
| PubChem CID | 79713745 |
| Molecular Formula | C14H16FN3 |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | N-ethyl-1-(5-fluoro-2-pyridinyl)-2-pyridin-4-ylethanamine |
| SMILES | CCNC(Cc1ccncc1)c1ccc(F)cn1 |
| InChI | InChI=1S/C14H16FN3/c1-2-17-14(9-11-5-7-16-8-6-11)13-4-3-12(15)10-18-13/h3-8,10,14,17H,2,9H2,1H3 |
| InChIKey | VWRDVSMLSUPCQK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |