About 2-(3,5-dimethylphenoxy)-N-methyl-N-(piperidin-4-ylmethyl)ethanamine
2-(3,5-dimethylphenoxy)-N-methyl-N-(piperidin-4-ylmethyl)ethanamine (PubChem CID 79716779) has the molecular formula C17H28N2O
and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)-N-methyl-N-(piperidin-4-ylmethyl)ethanamine.
Molecular Properties
| Compound Name | 2-(3,5-dimethylphenoxy)-N-methyl-N-(piperidin-4-ylmethyl)ethanamine |
| PubChem CID | 79716779 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)-N-methyl-N-(piperidin-4-ylmethyl)ethanamine |
| SMILES | Cc1cc(C)cc(OCCN(C)CC2CCNCC2)c1 |
| InChI | InChI=1S/C17H28N2O/c1-14-10-15(2)12-17(11-14)20-9-8-19(3)13-16-4-6-18-7-5-16/h10-12,16,18H,4-9,13H2,1-3H3 |
| InChIKey | MHGPGWXXZANIFN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,5-dimethylphenoxy)-N-methyl-N-(piperidin-4-ylmethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethylphenoxy)-N-methyl-N-(piperidin-4-ylmethyl)ethanamine?
The IUPAC name of 2-(3,5-dimethylphenoxy)-N-methyl-N-(piperidin-4-ylmethyl)ethanamine (CID 79716779) is 2-(3,5-dimethylphenoxy)-N-methyl-N-(piperidin-4-ylmethyl)ethanamine.
What is the SMILES notation for 2-(3,5-dimethylphenoxy)-N-methyl-N-(piperidin-4-ylmethyl)ethanamine?
The canonical SMILES for 2-(3,5-dimethylphenoxy)-N-methyl-N-(piperidin-4-ylmethyl)ethanamine is Cc1cc(C)cc(OCCN(C)CC2CCNCC2)c1.
What is the InChIKey of 2-(3,5-dimethylphenoxy)-N-methyl-N-(piperidin-4-ylmethyl)ethanamine?
The InChIKey is MHGPGWXXZANIFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O/c1-14-10-15(2)12-17(11-14)20-9-8-19(3)13-16-4-6-18-7-5-16/h10-12,16,18H,4-9,13H2,1-3H3.
What are the key properties of 2-(3,5-dimethylphenoxy)-N-methyl-N-(piperidin-4-ylmethyl)ethanamine?
2-(3,5-dimethylphenoxy)-N-methyl-N-(piperidin-4-ylmethyl)ethanamine has a molecular weight of 276.42 g/mol, XLogP of 2.61, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethylphenoxy)-N-methyl-N-(piperidin-4-ylmethyl)ethanamine is sourced from PubChem (CID 79716779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).