C13H22F2N4 — CID 79717441
N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-(piperidin-4-ylmethyl)ethanamine (PubChem CID 79717441) has the molecular formula C13H22F2N4 and a molecular weight of 272.34 g/mol. Its IUPAC name is N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-(piperidin-4-ylmethyl)ethanamine.
| Compound Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-(piperidin-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 79717441 |
| Molecular Formula | C13H22F2N4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-(piperidin-4-ylmethyl)ethanamine |
| SMILES | CCN(Cc1nccn1C(F)F)CC1CCNCC1 |
| InChI | InChI=1S/C13H22F2N4/c1-2-18(9-11-3-5-16-6-4-11)10-12-17-7-8-19(12)13(14)15/h7-8,11,13,16H,2-6,9-10H2,1H3 |
| InChIKey | LPXHPDWMKUYDQB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |