C13H15FN4 — CID 79718258
2-(5-fluoro-2-pyridinyl)-6-methyl-N-propylpyrimidin-4-amine (PubChem CID 79718258) has the molecular formula C13H15FN4 and a molecular weight of 246.29 g/mol. Its IUPAC name is 2-(5-fluoro-2-pyridinyl)-6-methyl-N-propylpyrimidin-4-amine.
| Compound Name | 2-(5-fluoro-2-pyridinyl)-6-methyl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 79718258 |
| Molecular Formula | C13H15FN4 |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2-(5-fluoro-2-pyridinyl)-6-methyl-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1cc(C)nc(-c2ccc(F)cn2)n1 |
| InChI | InChI=1S/C13H15FN4/c1-3-6-15-12-7-9(2)17-13(18-12)11-5-4-10(14)8-16-11/h4-5,7-8H,3,6H2,1-2H3,(H,15,17,18) |
| InChIKey | UEQVQIUEEXMGRP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |