C16H15BrN2O — CID 79719160
2-amino-N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4-bromobenzamide (PubChem CID 79719160) has the molecular formula C16H15BrN2O and a molecular weight of 331.21 g/mol. Its IUPAC name is 2-amino-N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4-bromobenzamide.
| Compound Name | 2-amino-N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4-bromobenzamide |
|---|---|
| PubChem CID | 79719160 |
| Molecular Formula | C16H15BrN2O |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 2-amino-N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4-bromobenzamide |
| SMILES | Nc1cc(Br)ccc1C(=O)NCC1Cc2ccccc21 |
| InChI | InChI=1S/C16H15BrN2O/c17-12-5-6-14(15(18)8-12)16(20)19-9-11-7-10-3-1-2-4-13(10)11/h1-6,8,11H,7,9,18H2,(H,19,20) |
| InChIKey | STILYQKKJDGXTF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|