C14H22N4O2 — CID 79719766
4-nitro-N-(piperidin-4-ylmethyl)-N-propylpyridin-2-amine (PubChem CID 79719766) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-nitro-N-(piperidin-4-ylmethyl)-N-propylpyridin-2-amine.
| Compound Name | 4-nitro-N-(piperidin-4-ylmethyl)-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 79719766 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 4-nitro-N-(piperidin-4-ylmethyl)-N-propylpyridin-2-amine |
| SMILES | CCCN(CC1CCNCC1)c1cc([N+](=O)[O-])ccn1 |
| InChI | InChI=1S/C14H22N4O2/c1-2-9-17(11-12-3-6-15-7-4-12)14-10-13(18(19)20)5-8-16-14/h5,8,10,12,15H,2-4,6-7,9,11H2,1H3 |
| InChIKey | XQGRUDPSMQYFFQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|