C16H22ClN3 — CID 79719772
2-chloro-4-[piperidin-4-ylmethyl(propan-2-yl)amino]benzonitrile (PubChem CID 79719772) has the molecular formula C16H22ClN3 and a molecular weight of 291.83 g/mol. Its IUPAC name is 2-chloro-4-[piperidin-4-ylmethyl(propan-2-yl)amino]benzonitrile.
| Compound Name | 2-chloro-4-[piperidin-4-ylmethyl(propan-2-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 79719772 |
| Molecular Formula | C16H22ClN3 |
| Molecular Weight | 291.83 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-chloro-4-[piperidin-4-ylmethyl(propan-2-yl)amino]benzonitrile |
| SMILES | CC(C)N(CC1CCNCC1)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C16H22ClN3/c1-12(2)20(11-13-5-7-19-8-6-13)15-4-3-14(10-18)16(17)9-15/h3-4,9,12-13,19H,5-8,11H2,1-2H3 |
| InChIKey | RROKZMHBTOKGLN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.83 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |