C16H13N3O2 — CID 79721891
6-(5-amino-2,3-dihydro-1H-inden-1-yl)pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 79721891) has the molecular formula C16H13N3O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is 6-(5-amino-2,3-dihydro-1H-inden-1-yl)pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-(5-amino-2,3-dihydro-1H-inden-1-yl)pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 79721891 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 6-(5-amino-2,3-dihydro-1H-inden-1-yl)pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | Nc1ccc2c(c1)CCC2N1C(=O)c2cccnc2C1=O |
| InChI | InChI=1S/C16H13N3O2/c17-10-4-5-11-9(8-10)3-6-13(11)19-15(20)12-2-1-7-18-14(12)16(19)21/h1-2,4-5,7-8,13H,3,6,17H2 |
| InChIKey | JOAIAVDKGDVZMZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|