About 6-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-sulfonamide
6-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-sulfonamide (PubChem CID 79722672) has the molecular formula C14H16N4O2S
and a molecular weight of 304.38 g/mol. Its IUPAC name is 6-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 6-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-sulfonamide |
| PubChem CID | 79722672 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 6-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-sulfonamide |
| SMILES | Nc1ccc2c(c1)CCC2Nc1ccc(S(N)(=O)=O)cn1 |
| InChI | InChI=1S/C14H16N4O2S/c15-10-2-4-12-9(7-10)1-5-13(12)18-14-6-3-11(8-17-14)21(16,19)20/h2-4,6-8,13H,1,5,15H2,(H,17,18)(H2,16,19,20) |
| InChIKey | ZIXCPDVQOOAOMH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-sulfonamide?
The IUPAC name of 6-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-sulfonamide (CID 79722672) is 6-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-sulfonamide.
What is the SMILES notation for 6-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-sulfonamide?
The canonical SMILES for 6-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-sulfonamide is Nc1ccc2c(c1)CCC2Nc1ccc(S(N)(=O)=O)cn1.
What is the InChIKey of 6-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-sulfonamide?
The InChIKey is ZIXCPDVQOOAOMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O2S/c15-10-2-4-12-9(7-10)1-5-13(12)18-14-6-3-11(8-17-14)21(16,19)20/h2-4,6-8,13H,1,5,15H2,(H,17,18)(H2,16,19,20).
What are the key properties of 6-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-sulfonamide?
6-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-sulfonamide has a molecular weight of 304.38 g/mol, XLogP of 1.41, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(5-amino-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-sulfonamide is sourced from PubChem (CID 79722672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).