C17H18BrF2N — CID 79723126
N-[(5-bromo-2-fluorophenyl)-(5-fluoro-2-methylphenyl)methyl]propan-1-amine (PubChem CID 79723126) has the molecular formula C17H18BrF2N and a molecular weight of 354.24 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)-(5-fluoro-2-methylphenyl)methyl]propan-1-amine.
| Compound Name | N-[(5-bromo-2-fluorophenyl)-(5-fluoro-2-methylphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 79723126 |
| Molecular Formula | C17H18BrF2N |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)-(5-fluoro-2-methylphenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cc(F)ccc1C)c1cc(Br)ccc1F |
| InChI | InChI=1S/C17H18BrF2N/c1-3-8-21-17(14-10-13(19)6-4-11(14)2)15-9-12(18)5-7-16(15)20/h4-7,9-10,17,21H,3,8H2,1-2H3 |
| InChIKey | IINZLCCLHXGNJV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |