C18H21ClN2 — CID 79723423
N-[[5-chloro-2-[(5-ethyl-2-pyridinyl)methyl]phenyl]methyl]cyclopropanamine (PubChem CID 79723423) has the molecular formula C18H21ClN2 and a molecular weight of 300.83 g/mol. Its IUPAC name is N-[[5-chloro-2-[(5-ethyl-2-pyridinyl)methyl]phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[5-chloro-2-[(5-ethyl-2-pyridinyl)methyl]phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 79723423 |
| Molecular Formula | C18H21ClN2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-[[5-chloro-2-[(5-ethyl-2-pyridinyl)methyl]phenyl]methyl]cyclopropanamine |
| SMILES | CCc1ccc(Cc2ccc(Cl)cc2CNC2CC2)nc1 |
| InChI | InChI=1S/C18H21ClN2/c1-2-13-3-6-18(20-11-13)10-14-4-5-16(19)9-15(14)12-21-17-7-8-17/h3-6,9,11,17,21H,2,7-8,10,12H2,1H3 |
| InChIKey | VDXSGLGXRDUQQX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |