C12H6F3NO — CID 79723476
(3,5-difluorophenyl)-(5-fluoro-2-pyridinyl)methanone (PubChem CID 79723476) has the molecular formula C12H6F3NO and a molecular weight of 237.18 g/mol. Its IUPAC name is (3,5-difluorophenyl)-(5-fluoro-2-pyridinyl)methanone.
| Compound Name | (3,5-difluorophenyl)-(5-fluoro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 79723476 |
| Molecular Formula | C12H6F3NO |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | (3,5-difluorophenyl)-(5-fluoro-2-pyridinyl)methanone |
| SMILES | O=C(c1cc(F)cc(F)c1)c1ccc(F)cn1 |
| InChI | InChI=1S/C12H6F3NO/c13-8-1-2-11(16-6-8)12(17)7-3-9(14)5-10(15)4-7/h1-6H |
| InChIKey | ABASFBBOFKJCEJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |