C28H30N2O2 — CID 7972356
N,N'-bis(2,4-dimethylphenyl)-2-[(4-ethylphenyl)methylidene]propanediamide (PubChem CID 7972356) has the molecular formula C28H30N2O2 and a molecular weight of 426.56 g/mol. Its IUPAC name is N,N'-bis(2,4-dimethylphenyl)-2-[(4-ethylphenyl)methylidene]propanediamide.
| Compound Name | N,N'-bis(2,4-dimethylphenyl)-2-[(4-ethylphenyl)methylidene]propanediamide |
|---|---|
| PubChem CID | 7972356 |
| Molecular Formula | C28H30N2O2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N,N'-bis(2,4-dimethylphenyl)-2-[(4-ethylphenyl)methylidene]propanediamide |
| SMILES | CCc1ccc(C=C(C(=O)Nc2ccc(C)cc2C)C(=O)Nc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C28H30N2O2/c1-6-22-9-11-23(12-10-22)17-24(27(31)29-25-13-7-18(2)15-20(25)4)28(32)30-26-14-8-19(3)16-21(26)5/h7-17H,6H2,1-5H3,(H,29,31)(H,30,32) |
| InChIKey | VKTYFBVBAIHXTH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|