C18H20N2O — CID 79723785
1-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2,3-dihydro-1H-inden-5-amine (PubChem CID 79723785) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2,3-dihydro-1H-inden-5-amine.
| Compound Name | 1-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2,3-dihydro-1H-inden-5-amine |
|---|---|
| PubChem CID | 79723785 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2,3-dihydro-1H-inden-5-amine |
| SMILES | Nc1ccc2c(c1)CCC2N1CCOc2ccccc2C1 |
| InChI | InChI=1S/C18H20N2O/c19-15-6-7-16-13(11-15)5-8-17(16)20-9-10-21-18-4-2-1-3-14(18)12-20/h1-4,6-7,11,17H,5,8-10,12,19H2 |
| InChIKey | WKOIXMCLGDISSZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|