About spiro[1,3-dihydroperimidine-2,1'-cyclohexane]
spiro[1,3-dihydroperimidine-2,1'-cyclohexane] (PubChem CID 797247) has the molecular formula C16H18N2
and a molecular weight of 238.33 g/mol. Its IUPAC name is spiro[1,3-dihydroperimidine-2,1'-cyclohexane].
Molecular Properties
| Compound Name | spiro[1,3-dihydroperimidine-2,1'-cyclohexane] |
| PubChem CID | 797247 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | spiro[1,3-dihydroperimidine-2,1'-cyclohexane] |
| SMILES | c1cc2c3c(cccc3c1)NC1(CCCCC1)N2 |
| InChI | InChI=1S/C16H18N2/c1-2-10-16(11-3-1)17-13-8-4-6-12-7-5-9-14(18-16)15(12)13/h4-9,17-18H,1-3,10-11H2 |
| InChIKey | KMAVVPHOTMNZLL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'} |
|---|
Analyze spiro[1,3-dihydroperimidine-2,1'-cyclohexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dihydroperimidine-2,1'-cyclohexane]?
The IUPAC name of spiro[1,3-dihydroperimidine-2,1'-cyclohexane] (CID 797247) is spiro[1,3-dihydroperimidine-2,1'-cyclohexane].
What is the SMILES notation for spiro[1,3-dihydroperimidine-2,1'-cyclohexane]?
The canonical SMILES for spiro[1,3-dihydroperimidine-2,1'-cyclohexane] is c1cc2c3c(cccc3c1)NC1(CCCCC1)N2.
What is the InChIKey of spiro[1,3-dihydroperimidine-2,1'-cyclohexane]?
The InChIKey is KMAVVPHOTMNZLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2/c1-2-10-16(11-3-1)17-13-8-4-6-12-7-5-9-14(18-16)15(12)13/h4-9,17-18H,1-3,10-11H2.
What are the key properties of spiro[1,3-dihydroperimidine-2,1'-cyclohexane]?
spiro[1,3-dihydroperimidine-2,1'-cyclohexane] has a molecular weight of 238.33 g/mol, XLogP of 4.34, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dihydroperimidine-2,1'-cyclohexane] is sourced from PubChem (CID 797247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).