C14H20N2O2S — CID 79724800
1-N-(3-methyl-1,1-dioxothiolan-3-yl)-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 79724800) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 1-N-(3-methyl-1,1-dioxothiolan-3-yl)-2,3-dihydro-1H-indene-1,5-diamine.
| Compound Name | 1-N-(3-methyl-1,1-dioxothiolan-3-yl)-2,3-dihydro-1H-indene-1,5-diamine |
|---|---|
| PubChem CID | 79724800 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 1-N-(3-methyl-1,1-dioxothiolan-3-yl)-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | CC1(NC2CCc3cc(N)ccc32)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H20N2O2S/c1-14(6-7-19(17,18)9-14)16-13-5-2-10-8-11(15)3-4-12(10)13/h3-4,8,13,16H,2,5-7,9,15H2,1H3 |
| InChIKey | UMKZIVIYRXXHOC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|