About 6-bromo-4-fluoro-N,2-dimethyl-2,3-dihydro-1H-inden-1-amine
6-bromo-4-fluoro-N,2-dimethyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 79725398) has the molecular formula C11H13BrFN
and a molecular weight of 258.13 g/mol. Its IUPAC name is 6-bromo-4-fluoro-N,2-dimethyl-2,3-dihydro-1H-inden-1-amine.
Molecular Properties
| Compound Name | 6-bromo-4-fluoro-N,2-dimethyl-2,3-dihydro-1H-inden-1-amine |
| PubChem CID | 79725398 |
| Molecular Formula | C11H13BrFN |
| Molecular Weight | 258.13 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 6-bromo-4-fluoro-N,2-dimethyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CNC1c2cc(Br)cc(F)c2CC1C |
| InChI | InChI=1S/C11H13BrFN/c1-6-3-8-9(11(6)14-2)4-7(12)5-10(8)13/h4-6,11,14H,3H2,1-2H3 |
| InChIKey | MIQAGIPWDCKJFR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.13 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-4-fluoro-N,2-dimethyl-2,3-dihydro-1H-inden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-fluoro-N,2-dimethyl-2,3-dihydro-1H-inden-1-amine?
The IUPAC name of 6-bromo-4-fluoro-N,2-dimethyl-2,3-dihydro-1H-inden-1-amine (CID 79725398) is 6-bromo-4-fluoro-N,2-dimethyl-2,3-dihydro-1H-inden-1-amine.
What is the SMILES notation for 6-bromo-4-fluoro-N,2-dimethyl-2,3-dihydro-1H-inden-1-amine?
The canonical SMILES for 6-bromo-4-fluoro-N,2-dimethyl-2,3-dihydro-1H-inden-1-amine is CNC1c2cc(Br)cc(F)c2CC1C.
What is the InChIKey of 6-bromo-4-fluoro-N,2-dimethyl-2,3-dihydro-1H-inden-1-amine?
The InChIKey is MIQAGIPWDCKJFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrFN/c1-6-3-8-9(11(6)14-2)4-7(12)5-10(8)13/h4-6,11,14H,3H2,1-2H3.
What are the key properties of 6-bromo-4-fluoro-N,2-dimethyl-2,3-dihydro-1H-inden-1-amine?
6-bromo-4-fluoro-N,2-dimethyl-2,3-dihydro-1H-inden-1-amine has a molecular weight of 258.13 g/mol, XLogP of 3.04, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-fluoro-N,2-dimethyl-2,3-dihydro-1H-inden-1-amine is sourced from PubChem (CID 79725398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).