C14H19NO5 — CID 79725836
4-[(3-hydroxy-4-methoxybenzoyl)amino]-4-methylpentanoic acid (PubChem CID 79725836) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is 4-[(3-hydroxy-4-methoxybenzoyl)amino]-4-methylpentanoic acid.
| Compound Name | 4-[(3-hydroxy-4-methoxybenzoyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 79725836 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-[(3-hydroxy-4-methoxybenzoyl)amino]-4-methylpentanoic acid |
| SMILES | COc1ccc(C(=O)NC(C)(C)CCC(=O)O)cc1O |
| InChI | InChI=1S/C14H19NO5/c1-14(2,7-6-12(17)18)15-13(19)9-4-5-11(20-3)10(16)8-9/h4-5,8,16H,6-7H2,1-3H3,(H,15,19)(H,17,18) |
| InChIKey | LJWSHPHIDVWPLF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |