C14H21N — CID 79725988
N-ethyl-2,4,6-trimethyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 79725988) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is N-ethyl-2,4,6-trimethyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-ethyl-2,4,6-trimethyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 79725988 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | N-ethyl-2,4,6-trimethyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CCNC1c2cc(C)cc(C)c2CC1C |
| InChI | InChI=1S/C14H21N/c1-5-15-14-11(4)8-12-10(3)6-9(2)7-13(12)14/h6-7,11,14-15H,5,8H2,1-4H3 |
| InChIKey | OYCISUADWSXWMH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |