About 4,6-difluoro-2-methyl-2,3-dihydro-1H-inden-1-ol
4,6-difluoro-2-methyl-2,3-dihydro-1H-inden-1-ol (PubChem CID 79726126) has the molecular formula C10H10F2O
and a molecular weight of 184.19 g/mol. Its IUPAC name is 4,6-difluoro-2-methyl-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 4,6-difluoro-2-methyl-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 79726126 |
| Molecular Formula | C10H10F2O |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 4,6-difluoro-2-methyl-2,3-dihydro-1H-inden-1-ol |
| SMILES | CC1Cc2c(F)cc(F)cc2C1O |
| InChI | InChI=1S/C10H10F2O/c1-5-2-7-8(10(5)13)3-6(11)4-9(7)12/h3-5,10,13H,2H2,1H3 |
| InChIKey | NJEHZHSEZYPZSY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,6-difluoro-2-methyl-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-difluoro-2-methyl-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 4,6-difluoro-2-methyl-2,3-dihydro-1H-inden-1-ol (CID 79726126) is 4,6-difluoro-2-methyl-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 4,6-difluoro-2-methyl-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 4,6-difluoro-2-methyl-2,3-dihydro-1H-inden-1-ol is CC1Cc2c(F)cc(F)cc2C1O.
What is the InChIKey of 4,6-difluoro-2-methyl-2,3-dihydro-1H-inden-1-ol?
The InChIKey is NJEHZHSEZYPZSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2O/c1-5-2-7-8(10(5)13)3-6(11)4-9(7)12/h3-5,10,13H,2H2,1H3.
What are the key properties of 4,6-difluoro-2-methyl-2,3-dihydro-1H-inden-1-ol?
4,6-difluoro-2-methyl-2,3-dihydro-1H-inden-1-ol has a molecular weight of 184.19 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-difluoro-2-methyl-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 79726126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).