C17H25N3 — CID 79726521
1-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 79726521) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 1-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-2,3-dihydro-1H-indene-1,5-diamine.
| Compound Name | 1-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-2,3-dihydro-1H-indene-1,5-diamine |
|---|---|
| PubChem CID | 79726521 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 1-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | Nc1ccc2c(c1)CCC2NC1CCN2CCCCC12 |
| InChI | InChI=1S/C17H25N3/c18-13-5-6-14-12(11-13)4-7-15(14)19-16-8-10-20-9-2-1-3-17(16)20/h5-6,11,15-17,19H,1-4,7-10,18H2 |
| InChIKey | DDJRWBPVKXSUIO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|