3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid

C8H9FN2O2 — CID 79726690

IUPAC3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid
SMILESCc1c(C=C(F)C(=O)O)cnn1C
InChIInChI=1S/C8H9FN2O2/c1-5-6(4-10-11(5)2)3-7(9)8(12)13/h3-4H,1-2H3,(H,12,13)
InChIKeyIXLCNKVEKBYQOZ-UHFFFAOYSA-N
MW184.17 g/mol
LogP1.12
Rot. Bonds2

About 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid

3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid (PubChem CID 79726690) has the molecular formula C8H9FN2O2 and a molecular weight of 184.17 g/mol. Its IUPAC name is 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid.

Molecular Properties

Compound Name3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid
PubChem CID79726690
Molecular FormulaC8H9FN2O2
Molecular Weight184.17 g/mol
Exact Mass184.06
IUPAC Name3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid
SMILESCc1c(C=C(F)C(=O)O)cnn1C
InChIInChI=1S/C8H9FN2O2/c1-5-6(4-10-11(5)2)3-7(9)8(12)13/h3-4H,1-2H3,(H,12,13)
InChIKeyIXLCNKVEKBYQOZ-UHFFFAOYSA-N
XLogP1.12
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.17
LogP ≤ 51.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid?
The IUPAC name of 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid (CID 79726690) is 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid.
What is the SMILES notation for 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid?
The canonical SMILES for 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid is Cc1c(C=C(F)C(=O)O)cnn1C.
What is the InChIKey of 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid?
The InChIKey is IXLCNKVEKBYQOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FN2O2/c1-5-6(4-10-11(5)2)3-7(9)8(12)13/h3-4H,1-2H3,(H,12,13).
What are the key properties of 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid?
3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid has a molecular weight of 184.17 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid is sourced from PubChem (CID 79726690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).