About 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid
3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid (PubChem CID 79726690) has the molecular formula C8H9FN2O2
and a molecular weight of 184.17 g/mol. Its IUPAC name is 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid.
Molecular Properties
| Compound Name | 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid |
| PubChem CID | 79726690 |
| Molecular Formula | C8H9FN2O2 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid |
| SMILES | Cc1c(C=C(F)C(=O)O)cnn1C |
| InChI | InChI=1S/C8H9FN2O2/c1-5-6(4-10-11(5)2)3-7(9)8(12)13/h3-4H,1-2H3,(H,12,13) |
| InChIKey | IXLCNKVEKBYQOZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid?
The IUPAC name of 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid (CID 79726690) is 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid.
What is the SMILES notation for 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid?
The canonical SMILES for 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid is Cc1c(C=C(F)C(=O)O)cnn1C.
What is the InChIKey of 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid?
The InChIKey is IXLCNKVEKBYQOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FN2O2/c1-5-6(4-10-11(5)2)3-7(9)8(12)13/h3-4H,1-2H3,(H,12,13).
What are the key properties of 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid?
3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid has a molecular weight of 184.17 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,5-dimethylpyrazol-4-yl)-2-fluoroprop-2-enoic acid is sourced from PubChem (CID 79726690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).