About 4-fluoro-2,3-dimethyl-2,3-dihydro-1H-inden-1-ol
4-fluoro-2,3-dimethyl-2,3-dihydro-1H-inden-1-ol (PubChem CID 79726794) has the molecular formula C11H13FO
and a molecular weight of 180.22 g/mol. Its IUPAC name is 4-fluoro-2,3-dimethyl-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 4-fluoro-2,3-dimethyl-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 79726794 |
| Molecular Formula | C11H13FO |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 4-fluoro-2,3-dimethyl-2,3-dihydro-1H-inden-1-ol |
| SMILES | CC1c2c(F)cccc2C(O)C1C |
| InChI | InChI=1S/C11H13FO/c1-6-7(2)11(13)8-4-3-5-9(12)10(6)8/h3-7,11,13H,1-2H3 |
| InChIKey | BCMHBGVERIFOEC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-2,3-dimethyl-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2,3-dimethyl-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 4-fluoro-2,3-dimethyl-2,3-dihydro-1H-inden-1-ol (CID 79726794) is 4-fluoro-2,3-dimethyl-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 4-fluoro-2,3-dimethyl-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 4-fluoro-2,3-dimethyl-2,3-dihydro-1H-inden-1-ol is CC1c2c(F)cccc2C(O)C1C.
What is the InChIKey of 4-fluoro-2,3-dimethyl-2,3-dihydro-1H-inden-1-ol?
The InChIKey is BCMHBGVERIFOEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FO/c1-6-7(2)11(13)8-4-3-5-9(12)10(6)8/h3-7,11,13H,1-2H3.
What are the key properties of 4-fluoro-2,3-dimethyl-2,3-dihydro-1H-inden-1-ol?
4-fluoro-2,3-dimethyl-2,3-dihydro-1H-inden-1-ol has a molecular weight of 180.22 g/mol, XLogP of 2.61, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2,3-dimethyl-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 79726794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).