About 5-chloro-3-fluoro-2-(3,3,5-trimethylcyclohexyl)oxypyridine
5-chloro-3-fluoro-2-(3,3,5-trimethylcyclohexyl)oxypyridine (PubChem CID 79727605) has the molecular formula C14H19ClFNO
and a molecular weight of 271.76 g/mol. Its IUPAC name is 5-chloro-3-fluoro-2-(3,3,5-trimethylcyclohexyl)oxypyridine.
Molecular Properties
| Compound Name | 5-chloro-3-fluoro-2-(3,3,5-trimethylcyclohexyl)oxypyridine |
| PubChem CID | 79727605 |
| Molecular Formula | C14H19ClFNO |
| Molecular Weight | 271.76 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 5-chloro-3-fluoro-2-(3,3,5-trimethylcyclohexyl)oxypyridine |
| SMILES | CC1CC(Oc2ncc(Cl)cc2F)CC(C)(C)C1 |
| InChI | InChI=1S/C14H19ClFNO/c1-9-4-11(7-14(2,3)6-9)18-13-12(16)5-10(15)8-17-13/h5,8-9,11H,4,6-7H2,1-3H3 |
| InChIKey | RXIGNEFGVFHTNJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.76 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-3-fluoro-2-(3,3,5-trimethylcyclohexyl)oxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-fluoro-2-(3,3,5-trimethylcyclohexyl)oxypyridine?
The IUPAC name of 5-chloro-3-fluoro-2-(3,3,5-trimethylcyclohexyl)oxypyridine (CID 79727605) is 5-chloro-3-fluoro-2-(3,3,5-trimethylcyclohexyl)oxypyridine.
What is the SMILES notation for 5-chloro-3-fluoro-2-(3,3,5-trimethylcyclohexyl)oxypyridine?
The canonical SMILES for 5-chloro-3-fluoro-2-(3,3,5-trimethylcyclohexyl)oxypyridine is CC1CC(Oc2ncc(Cl)cc2F)CC(C)(C)C1.
What is the InChIKey of 5-chloro-3-fluoro-2-(3,3,5-trimethylcyclohexyl)oxypyridine?
The InChIKey is RXIGNEFGVFHTNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClFNO/c1-9-4-11(7-14(2,3)6-9)18-13-12(16)5-10(15)8-17-13/h5,8-9,11H,4,6-7H2,1-3H3.
What are the key properties of 5-chloro-3-fluoro-2-(3,3,5-trimethylcyclohexyl)oxypyridine?
5-chloro-3-fluoro-2-(3,3,5-trimethylcyclohexyl)oxypyridine has a molecular weight of 271.76 g/mol, XLogP of 4.47, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-fluoro-2-(3,3,5-trimethylcyclohexyl)oxypyridine is sourced from PubChem (CID 79727605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).