About N'-(5-chloro-3-fluoro-2-pyridinyl)-N'-ethyl-2,2-dimethylpropane-1,3-diamine
N'-(5-chloro-3-fluoro-2-pyridinyl)-N'-ethyl-2,2-dimethylpropane-1,3-diamine (PubChem CID 79727656) has the molecular formula C12H19ClFN3
and a molecular weight of 259.76 g/mol. Its IUPAC name is N'-(5-chloro-3-fluoro-2-pyridinyl)-N'-ethyl-2,2-dimethylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(5-chloro-3-fluoro-2-pyridinyl)-N'-ethyl-2,2-dimethylpropane-1,3-diamine |
| PubChem CID | 79727656 |
| Molecular Formula | C12H19ClFN3 |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | N'-(5-chloro-3-fluoro-2-pyridinyl)-N'-ethyl-2,2-dimethylpropane-1,3-diamine |
| SMILES | CCN(CC(C)(C)CN)c1ncc(Cl)cc1F |
| InChI | InChI=1S/C12H19ClFN3/c1-4-17(8-12(2,3)7-15)11-10(14)5-9(13)6-16-11/h5-6H,4,7-8,15H2,1-3H3 |
| InChIKey | SEKAYSRMIQLGHC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-(5-chloro-3-fluoro-2-pyridinyl)-N'-ethyl-2,2-dimethylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-chloro-3-fluoro-2-pyridinyl)-N'-ethyl-2,2-dimethylpropane-1,3-diamine?
The IUPAC name of N'-(5-chloro-3-fluoro-2-pyridinyl)-N'-ethyl-2,2-dimethylpropane-1,3-diamine (CID 79727656) is N'-(5-chloro-3-fluoro-2-pyridinyl)-N'-ethyl-2,2-dimethylpropane-1,3-diamine.
What is the SMILES notation for N'-(5-chloro-3-fluoro-2-pyridinyl)-N'-ethyl-2,2-dimethylpropane-1,3-diamine?
The canonical SMILES for N'-(5-chloro-3-fluoro-2-pyridinyl)-N'-ethyl-2,2-dimethylpropane-1,3-diamine is CCN(CC(C)(C)CN)c1ncc(Cl)cc1F.
What is the InChIKey of N'-(5-chloro-3-fluoro-2-pyridinyl)-N'-ethyl-2,2-dimethylpropane-1,3-diamine?
The InChIKey is SEKAYSRMIQLGHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19ClFN3/c1-4-17(8-12(2,3)7-15)11-10(14)5-9(13)6-16-11/h5-6H,4,7-8,15H2,1-3H3.
What are the key properties of N'-(5-chloro-3-fluoro-2-pyridinyl)-N'-ethyl-2,2-dimethylpropane-1,3-diamine?
N'-(5-chloro-3-fluoro-2-pyridinyl)-N'-ethyl-2,2-dimethylpropane-1,3-diamine has a molecular weight of 259.76 g/mol, XLogP of 2.69, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-chloro-3-fluoro-2-pyridinyl)-N'-ethyl-2,2-dimethylpropane-1,3-diamine is sourced from PubChem (CID 79727656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).