C12H17ClFN3 — CID 79727754
N-[2-(aminomethyl)cyclohexyl]-5-chloro-3-fluoropyridin-2-amine (PubChem CID 79727754) has the molecular formula C12H17ClFN3 and a molecular weight of 257.74 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-5-chloro-3-fluoropyridin-2-amine.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-5-chloro-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 79727754 |
| Molecular Formula | C12H17ClFN3 |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-5-chloro-3-fluoropyridin-2-amine |
| SMILES | NCC1CCCCC1Nc1ncc(Cl)cc1F |
| InChI | InChI=1S/C12H17ClFN3/c13-9-5-10(14)12(16-7-9)17-11-4-2-1-3-8(11)6-15/h5,7-8,11H,1-4,6,15H2,(H,16,17) |
| InChIKey | IHRLPFQDQVSTCF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |