C12H6Cl2F4N2 — CID 79727796
5-chloro-N-[2-chloro-4-(trifluoromethyl)phenyl]-3-fluoropyridin-2-amine (PubChem CID 79727796) has the molecular formula C12H6Cl2F4N2 and a molecular weight of 325.09 g/mol. Its IUPAC name is 5-chloro-N-[2-chloro-4-(trifluoromethyl)phenyl]-3-fluoropyridin-2-amine.
| Compound Name | 5-chloro-N-[2-chloro-4-(trifluoromethyl)phenyl]-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 79727796 |
| Molecular Formula | C12H6Cl2F4N2 |
| Molecular Weight | 325.09 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | 5-chloro-N-[2-chloro-4-(trifluoromethyl)phenyl]-3-fluoropyridin-2-amine |
| SMILES | Fc1cc(Cl)cnc1Nc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H6Cl2F4N2/c13-7-4-9(15)11(19-5-7)20-10-2-1-6(3-8(10)14)12(16,17)18/h1-5H,(H,19,20) |
| InChIKey | HPAWBLVRPAGJIO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.09 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |