About 4-(5-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylthiomorpholine
4-(5-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylthiomorpholine (PubChem CID 79728718) has the molecular formula C11H14ClFN2S
and a molecular weight of 260.76 g/mol. Its IUPAC name is 4-(5-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylthiomorpholine.
Molecular Properties
| Compound Name | 4-(5-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylthiomorpholine |
| PubChem CID | 79728718 |
| Molecular Formula | C11H14ClFN2S |
| Molecular Weight | 260.76 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 4-(5-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylthiomorpholine |
| SMILES | CC1CN(c2ncc(Cl)cc2F)CC(C)S1 |
| InChI | InChI=1S/C11H14ClFN2S/c1-7-5-15(6-8(2)16-7)11-10(13)3-9(12)4-14-11/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | CKQUGLUCJHBBDM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.76 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylthiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylthiomorpholine?
The IUPAC name of 4-(5-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylthiomorpholine (CID 79728718) is 4-(5-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylthiomorpholine.
What is the SMILES notation for 4-(5-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylthiomorpholine?
The canonical SMILES for 4-(5-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylthiomorpholine is CC1CN(c2ncc(Cl)cc2F)CC(C)S1.
What is the InChIKey of 4-(5-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylthiomorpholine?
The InChIKey is CKQUGLUCJHBBDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClFN2S/c1-7-5-15(6-8(2)16-7)11-10(13)3-9(12)4-14-11/h3-4,7-8H,5-6H2,1-2H3.
What are the key properties of 4-(5-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylthiomorpholine?
4-(5-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylthiomorpholine has a molecular weight of 260.76 g/mol, XLogP of 3.20, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylthiomorpholine is sourced from PubChem (CID 79728718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).