C13H12BrClN4O — CID 79729244
N-(5-bromo-4-methyl-2-pyridinyl)-5-chloro-2-hydrazinylbenzamide (PubChem CID 79729244) has the molecular formula C13H12BrClN4O and a molecular weight of 355.62 g/mol. Its IUPAC name is N-(5-bromo-4-methyl-2-pyridinyl)-5-chloro-2-hydrazinylbenzamide.
| Compound Name | N-(5-bromo-4-methyl-2-pyridinyl)-5-chloro-2-hydrazinylbenzamide |
|---|---|
| PubChem CID | 79729244 |
| Molecular Formula | C13H12BrClN4O |
| Molecular Weight | 355.62 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | N-(5-bromo-4-methyl-2-pyridinyl)-5-chloro-2-hydrazinylbenzamide |
| SMILES | Cc1cc(NC(=O)c2cc(Cl)ccc2NN)ncc1Br |
| InChI | InChI=1S/C13H12BrClN4O/c1-7-4-12(17-6-10(7)14)18-13(20)9-5-8(15)2-3-11(9)19-16/h2-6,19H,16H2,1H3,(H,17,18,20) |
| InChIKey | XHXMQTOFVHXVBG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.62 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|