C13H13FO4 — CID 79729459
3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-fluorobut-2-enoic acid (PubChem CID 79729459) has the molecular formula C13H13FO4 and a molecular weight of 252.24 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-fluorobut-2-enoic acid.
| Compound Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-fluorobut-2-enoic acid |
|---|---|
| PubChem CID | 79729459 |
| Molecular Formula | C13H13FO4 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-fluorobut-2-enoic acid |
| SMILES | CC(=C(F)C(=O)O)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C13H13FO4/c1-8(12(14)13(15)16)9-3-4-10-11(7-9)18-6-2-5-17-10/h3-4,7H,2,5-6H2,1H3,(H,15,16) |
| InChIKey | AGMIUCZGTWEHHP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|