C12H17N — CID 79729666
2,4,7-trimethyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 79729666) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is 2,4,7-trimethyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 2,4,7-trimethyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 79729666 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 2,4,7-trimethyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | Cc1ccc(C)c2c1CC(C)C2N |
| InChI | InChI=1S/C12H17N/c1-7-4-5-8(2)11-10(7)6-9(3)12(11)13/h4-5,9,12H,6,13H2,1-3H3 |
| InChIKey | ATYKIDOCTRMKBP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |