C14H19N5 — CID 79730964
4-N-[4-(1,2,4-triazol-1-yl)phenyl]cyclohexane-1,4-diamine (PubChem CID 79730964) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 4-N-[4-(1,2,4-triazol-1-yl)phenyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[4-(1,2,4-triazol-1-yl)phenyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 79730964 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 4-N-[4-(1,2,4-triazol-1-yl)phenyl]cyclohexane-1,4-diamine |
| SMILES | NC1CCC(Nc2ccc(-n3cncn3)cc2)CC1 |
| InChI | InChI=1S/C14H19N5/c15-11-1-3-12(4-2-11)18-13-5-7-14(8-6-13)19-10-16-9-17-19/h5-12,18H,1-4,15H2 |
| InChIKey | RDDQAYNBJDXREX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |