C14H17BrF2 — CID 79731863
5-bromo-1,3-difluoro-4,7,7-trimethyl-5,6,8,9-tetrahydrobenzo[7]annulene (PubChem CID 79731863) has the molecular formula C14H17BrF2 and a molecular weight of 303.19 g/mol. Its IUPAC name is 5-bromo-1,3-difluoro-4,7,7-trimethyl-5,6,8,9-tetrahydrobenzo[7]annulene.
| Compound Name | 5-bromo-1,3-difluoro-4,7,7-trimethyl-5,6,8,9-tetrahydrobenzo[7]annulene |
|---|---|
| PubChem CID | 79731863 |
| Molecular Formula | C14H17BrF2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 5-bromo-1,3-difluoro-4,7,7-trimethyl-5,6,8,9-tetrahydrobenzo[7]annulene |
| SMILES | Cc1c(F)cc(F)c2c1C(Br)CC(C)(C)CC2 |
| InChI | InChI=1S/C14H17BrF2/c1-8-11(16)6-12(17)9-4-5-14(2,3)7-10(15)13(8)9/h6,10H,4-5,7H2,1-3H3 |
| InChIKey | TWGFCEAYHSPHLW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|