C12H13BrF2 — CID 79731991
5-bromo-1,3-difluoro-4-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene (PubChem CID 79731991) has the molecular formula C12H13BrF2 and a molecular weight of 275.14 g/mol. Its IUPAC name is 5-bromo-1,3-difluoro-4-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene.
| Compound Name | 5-bromo-1,3-difluoro-4-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
|---|---|
| PubChem CID | 79731991 |
| Molecular Formula | C12H13BrF2 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 5-bromo-1,3-difluoro-4-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
| SMILES | Cc1c(F)cc(F)c2c1C(Br)CCCC2 |
| InChI | InChI=1S/C12H13BrF2/c1-7-10(14)6-11(15)8-4-2-3-5-9(13)12(7)8/h6,9H,2-5H2,1H3 |
| InChIKey | NLNAPWAYXIVCMR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|