C11H13N3O2S — CID 79732174
5-[5-(2-aminoethyl)-1,3,4-thiadiazol-2-yl]-2-methoxyphenol (PubChem CID 79732174) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 5-[5-(2-aminoethyl)-1,3,4-thiadiazol-2-yl]-2-methoxyphenol.
| Compound Name | 5-[5-(2-aminoethyl)-1,3,4-thiadiazol-2-yl]-2-methoxyphenol |
|---|---|
| PubChem CID | 79732174 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 5-[5-(2-aminoethyl)-1,3,4-thiadiazol-2-yl]-2-methoxyphenol |
| SMILES | COc1ccc(-c2nnc(CCN)s2)cc1O |
| InChI | InChI=1S/C11H13N3O2S/c1-16-9-3-2-7(6-8(9)15)11-14-13-10(17-11)4-5-12/h2-3,6,15H,4-5,12H2,1H3 |
| InChIKey | JTXDMVYCSCXPLB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |