About 5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2-methoxyphenol
5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2-methoxyphenol (PubChem CID 79732351) has the molecular formula C12H12N2O3
and a molecular weight of 232.24 g/mol. Its IUPAC name is 5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2-methoxyphenol.
Molecular Properties
| Compound Name | 5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2-methoxyphenol |
| PubChem CID | 79732351 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2-methoxyphenol |
| SMILES | COc1ccc(-c2nc(C3CC3)no2)cc1O |
| InChI | InChI=1S/C12H12N2O3/c1-16-10-5-4-8(6-9(10)15)12-13-11(14-17-12)7-2-3-7/h4-7,15H,2-3H2,1H3 |
| InChIKey | FBFRTOSMPGODCF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2-methoxyphenol?
The IUPAC name of 5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2-methoxyphenol (CID 79732351) is 5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2-methoxyphenol.
What is the SMILES notation for 5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2-methoxyphenol?
The canonical SMILES for 5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2-methoxyphenol is COc1ccc(-c2nc(C3CC3)no2)cc1O.
What is the InChIKey of 5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2-methoxyphenol?
The InChIKey is FBFRTOSMPGODCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3/c1-16-10-5-4-8(6-9(10)15)12-13-11(14-17-12)7-2-3-7/h4-7,15H,2-3H2,1H3.
What are the key properties of 5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2-methoxyphenol?
5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2-methoxyphenol has a molecular weight of 232.24 g/mol, XLogP of 2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2-methoxyphenol is sourced from PubChem (CID 79732351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).