C16H15Cl2FN2 — CID 79732423
1-(2,4-dichloro-5-fluorophenyl)-1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)ethanamine (PubChem CID 79732423) has the molecular formula C16H15Cl2FN2 and a molecular weight of 325.21 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-fluorophenyl)-1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)ethanamine.
| Compound Name | 1-(2,4-dichloro-5-fluorophenyl)-1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)ethanamine |
|---|---|
| PubChem CID | 79732423 |
| Molecular Formula | C16H15Cl2FN2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 1-(2,4-dichloro-5-fluorophenyl)-1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)ethanamine |
| SMILES | CC(N)(c1cc(F)c(Cl)cc1Cl)C1CCc2cccnc21 |
| InChI | InChI=1S/C16H15Cl2FN2/c1-16(20,11-7-14(19)13(18)8-12(11)17)10-5-4-9-3-2-6-21-15(9)10/h2-3,6-8,10H,4-5,20H2,1H3 |
| InChIKey | ZNXHXRDSYVWPQB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|